C15H21F3N4 — CID 167172874
8-ethyl-11-propan-2-yl-5-(trifluoromethyl)-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene (PubChem CID 167172874) has the molecular formula C15H21F3N4 and a molecular weight of 314.36 g/mol. Its IUPAC name is 8-ethyl-11-propan-2-yl-5-(trifluoromethyl)-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene.
| Compound Name | 8-ethyl-11-propan-2-yl-5-(trifluoromethyl)-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 167172874 |
| Molecular Formula | C15H21F3N4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 8-ethyl-11-propan-2-yl-5-(trifluoromethyl)-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene |
| SMILES | CCN1c2cc(C(F)(F)F)cnc2N2CCN(C(C)C)CC12 |
| InChI | InChI=1S/C15H21F3N4/c1-4-21-12-7-11(15(16,17)18)8-19-14(12)22-6-5-20(10(2)3)9-13(21)22/h7-8,10,13H,4-6,9H2,1-3H3 |
| InChIKey | JRGDSYCKKXCVRQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |