C16H21F3N4O — CID 171587693
(10S)-6,8-dimethyl-12-propan-2-yl-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one (PubChem CID 171587693) has the molecular formula C16H21F3N4O and a molecular weight of 342.37 g/mol. Its IUPAC name is (10S)-6,8-dimethyl-12-propan-2-yl-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one.
| Compound Name | (10S)-6,8-dimethyl-12-propan-2-yl-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 171587693 |
| Molecular Formula | C16H21F3N4O |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (10S)-6,8-dimethyl-12-propan-2-yl-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one |
| SMILES | Cc1c(C(F)(F)F)cnc2c1N(C)C(=O)[C@@H]1CN(C(C)C)CCN21 |
| InChI | InChI=1S/C16H21F3N4O/c1-9(2)22-5-6-23-12(8-22)15(24)21(4)13-10(3)11(16(17,18)19)7-20-14(13)23/h7,9,12H,5-6,8H2,1-4H3/t12-/m0/s1 |
| InChIKey | OUMRULXHNLQXPB-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |