C18H27N5O2 — CID 167173318
(10R)-8-methyl-5-morpholin-4-yl-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one (PubChem CID 167173318) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (10R)-8-methyl-5-morpholin-4-yl-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one.
| Compound Name | (10R)-8-methyl-5-morpholin-4-yl-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 167173318 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (10R)-8-methyl-5-morpholin-4-yl-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
| SMILES | CC(C)N1CCN2c3ncc(N4CCOCC4)cc3N(C)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C18H27N5O2/c1-13(2)22-4-5-23-16(12-22)18(24)20(3)15-10-14(11-19-17(15)23)21-6-8-25-9-7-21/h10-11,13,16H,4-9,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | NUCYDBJFYJIDED-MRXNPFEDSA-N |
| XLogP | 0.79 |
| TPSA | 52.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |