C14H17F3N4O — CID 171587773
(10S)-12-propan-2-yl-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one (PubChem CID 171587773) has the molecular formula C14H17F3N4O and a molecular weight of 314.31 g/mol. Its IUPAC name is (10S)-12-propan-2-yl-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one.
| Compound Name | (10S)-12-propan-2-yl-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 171587773 |
| Molecular Formula | C14H17F3N4O |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (10S)-12-propan-2-yl-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
| SMILES | CC(C)N1CCN2c3ncc(C(F)(F)F)cc3NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C14H17F3N4O/c1-8(2)20-3-4-21-11(7-20)13(22)19-10-5-9(14(15,16)17)6-18-12(10)21/h5-6,8,11H,3-4,7H2,1-2H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | SPXBEMBZWPOFKY-NSHDSACASA-N |
| XLogP | 1.95 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |