C16H20F3N5 — CID 171587753
(11R)-13-propan-2-yl-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-9-carbonitrile (PubChem CID 171587753) has the molecular formula C16H20F3N5 and a molecular weight of 339.37 g/mol. Its IUPAC name is (11R)-13-propan-2-yl-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-9-carbonitrile.
| Compound Name | (11R)-13-propan-2-yl-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-9-carbonitrile |
|---|---|
| PubChem CID | 171587753 |
| Molecular Formula | C16H20F3N5 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (11R)-13-propan-2-yl-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-9-carbonitrile |
| SMILES | CC(C)N1CCN2c3ncc(C(F)(F)F)cc3CN(C#N)C[C@H]2C1 |
| InChI | InChI=1S/C16H20F3N5/c1-11(2)23-3-4-24-14(9-23)8-22(10-20)7-12-5-13(16(17,18)19)6-21-15(12)24/h5-6,11,14H,3-4,7-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | RRZYYEVEDMKOGP-AWEZNQCLSA-N |
| XLogP | 2.30 |
| TPSA | 46.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|