C14H19F3N4O — CID 171587455
(11S)-13-propan-2-yl-5-(trifluoromethyl)-9-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene (PubChem CID 171587455) has the molecular formula C14H19F3N4O and a molecular weight of 316.33 g/mol. Its IUPAC name is (11S)-13-propan-2-yl-5-(trifluoromethyl)-9-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene.
| Compound Name | (11S)-13-propan-2-yl-5-(trifluoromethyl)-9-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
|---|---|
| PubChem CID | 171587455 |
| Molecular Formula | C14H19F3N4O |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (11S)-13-propan-2-yl-5-(trifluoromethyl)-9-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
| SMILES | CC(C)N1CCN2c3ncc(C(F)(F)F)nc3COC[C@@H]2C1 |
| InChI | InChI=1S/C14H19F3N4O/c1-9(2)20-3-4-21-10(6-20)7-22-8-11-13(21)18-5-12(19-11)14(15,16)17/h5,9-10H,3-4,6-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | VJHQMRRXQHAWED-JTQLQIEISA-N |
| XLogP | 1.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |