C14H17F5N4 — CID 167172880
8,8-difluoro-12-propan-2-yl-5-(trifluoromethyl)-1,3,6,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 167172880) has the molecular formula C14H17F5N4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 8,8-difluoro-12-propan-2-yl-5-(trifluoromethyl)-1,3,6,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | 8,8-difluoro-12-propan-2-yl-5-(trifluoromethyl)-1,3,6,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 167172880 |
| Molecular Formula | C14H17F5N4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 8,8-difluoro-12-propan-2-yl-5-(trifluoromethyl)-1,3,6,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | CC(C)N1CCN2c3ncc(C(F)(F)F)nc3C(F)(F)CC2C1 |
| InChI | InChI=1S/C14H17F5N4/c1-8(2)22-3-4-23-9(7-22)5-13(15,16)11-12(23)20-6-10(21-11)14(17,18)19/h6,8-9H,3-5,7H2,1-2H3 |
| InChIKey | OODMLVQHATXHAN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |