C16H22FN3 — CID 167173033
5-ethenyl-5-fluoro-8-propan-2-yl-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 167173033) has the molecular formula C16H22FN3 and a molecular weight of 275.37 g/mol. Its IUPAC name is 5-ethenyl-5-fluoro-8-propan-2-yl-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | 5-ethenyl-5-fluoro-8-propan-2-yl-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 167173033 |
| Molecular Formula | C16H22FN3 |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 5-ethenyl-5-fluoro-8-propan-2-yl-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | C=CC1(F)CC2CN(C(C)C)CCN2c2ncccc21 |
| InChI | InChI=1S/C16H22FN3/c1-4-16(17)10-13-11-19(12(2)3)8-9-20(13)15-14(16)6-5-7-18-15/h4-7,12-13H,1,8-11H2,2-3H3 |
| InChIKey | ZAURGWFBFOAYTM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|