C15H21F3N4O — CID 171587678
(11S)-13-tert-butyl-5-(trifluoromethyl)-9-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene (PubChem CID 171587678) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is (11S)-13-tert-butyl-5-(trifluoromethyl)-9-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene.
| Compound Name | (11S)-13-tert-butyl-5-(trifluoromethyl)-9-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
|---|---|
| PubChem CID | 171587678 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (11S)-13-tert-butyl-5-(trifluoromethyl)-9-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
| SMILES | CC(C)(C)N1CCN2c3ncc(C(F)(F)F)nc3COC[C@@H]2C1 |
| InChI | InChI=1S/C15H21F3N4O/c1-14(2,3)21-4-5-22-10(7-21)8-23-9-11-13(22)19-6-12(20-11)15(16,17)18/h6,10H,4-5,7-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | ICIKBEKUCFKZGQ-JTQLQIEISA-N |
| XLogP | 2.31 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |