C20H16F3NO3 — CID 15856838
ethyl 2-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]-1H-quinoline-3-carboxylate (PubChem CID 15856838) has the molecular formula C20H16F3NO3 and a molecular weight of 375.35 g/mol. Its IUPAC name is ethyl 2-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 15856838 |
| Molecular Formula | C20H16F3NO3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl 2-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cc2cccc(C(F)(F)F)c2)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C20H16F3NO3/c1-2-27-19(26)17-15(14-8-3-4-9-16(14)24-18(17)25)11-12-6-5-7-13(10-12)20(21,22)23/h3-10H,2,11H2,1H3,(H,24,25) |
| InChIKey | GYOQTLTVVOLNSY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |