C28H26N2O5 — CID 158569156
4-[3-(1,3-dioxolan-2-yl)-4-methoxyphenyl]pyridine;2-methoxy-5-pyridin-4-ylbenzaldehyde (PubChem CID 158569156) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-[3-(1,3-dioxolan-2-yl)-4-methoxyphenyl]pyridine;2-methoxy-5-pyridin-4-ylbenzaldehyde.
| Compound Name | 4-[3-(1,3-dioxolan-2-yl)-4-methoxyphenyl]pyridine;2-methoxy-5-pyridin-4-ylbenzaldehyde |
|---|---|
| PubChem CID | 158569156 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 4-[3-(1,3-dioxolan-2-yl)-4-methoxyphenyl]pyridine;2-methoxy-5-pyridin-4-ylbenzaldehyde |
| SMILES | COc1ccc(-c2ccncc2)cc1C1OCCO1.COc1ccc(-c2ccncc2)cc1C=O |
| InChI | InChI=1S/C15H15NO3.C13H11NO2/c1-17-14-3-2-12(11-4-6-16-7-5-11)10-13(14)15-18-8-9-19-15;1-16-13-3-2-11(8-12(13)9-15)10-4-6-14-7-5-10/h2-7,10,15H,8-9H2,1H3;2-9H,1H3 |
| InChIKey | HRWDIRDBFYXKEC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|