C23H30N4O — CID 158570682
2-butoxy-7-[(2-ethyl-3,4-dihydro-1H-isoquinolin-7-yl)methyl]-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 158570682) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-butoxy-7-[(2-ethyl-3,4-dihydro-1H-isoquinolin-7-yl)methyl]-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 2-butoxy-7-[(2-ethyl-3,4-dihydro-1H-isoquinolin-7-yl)methyl]-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 158570682 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-butoxy-7-[(2-ethyl-3,4-dihydro-1H-isoquinolin-7-yl)methyl]-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCCCOc1nc(N)c2c(n1)C(Cc1ccc3c(c1)CN(CC)CC3)=CC2 |
| InChI | InChI=1S/C23H30N4O/c1-3-5-12-28-23-25-21-18(8-9-20(21)22(24)26-23)13-16-6-7-17-10-11-27(4-2)15-19(17)14-16/h6-8,14H,3-5,9-13,15H2,1-2H3,(H2,24,25,26) |
| InChIKey | WCDZJYLTDCAMNL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|