C24H33N5O2 — CID 157064204
(4-amino-2-butoxy-5H-cyclopenta[d]pyrimidin-7-yl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanol (PubChem CID 157064204) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (4-amino-2-butoxy-5H-cyclopenta[d]pyrimidin-7-yl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanol.
| Compound Name | (4-amino-2-butoxy-5H-cyclopenta[d]pyrimidin-7-yl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 157064204 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (4-amino-2-butoxy-5H-cyclopenta[d]pyrimidin-7-yl)-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanol |
| SMILES | CCCCOc1nc(N)c2c(n1)C(C(O)c1ccc(CN3CCN(C)CC3)cc1)=CC2 |
| InChI | InChI=1S/C24H33N5O2/c1-3-4-15-31-24-26-21-19(9-10-20(21)23(25)27-24)22(30)18-7-5-17(6-8-18)16-29-13-11-28(2)12-14-29/h5-9,22,30H,3-4,10-16H2,1-2H3,(H2,25,26,27) |
| InChIKey | MYDFGCHHJDFYEQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|