C17H20N2O4 — CID 158575497
2,3-dihydroxypropyl 2-(2,3-dimethylanilino)pyridine-3-carboxylate (PubChem CID 158575497) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-(2,3-dimethylanilino)pyridine-3-carboxylate.
| Compound Name | 2,3-dihydroxypropyl 2-(2,3-dimethylanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 158575497 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2,3-dihydroxypropyl 2-(2,3-dimethylanilino)pyridine-3-carboxylate |
| SMILES | Cc1cccc(Nc2ncccc2C(=O)OCC(O)CO)c1C |
| InChI | InChI=1S/C17H20N2O4/c1-11-5-3-7-15(12(11)2)19-16-14(6-4-8-18-16)17(22)23-10-13(21)9-20/h3-8,13,20-21H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | HSPKQVRJIFAANS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |