C16H22O4 — CID 15857816
(3aR,5aR,8aR,9R,9aS)-9-hydroxy-1-(methoxymethyl)-5,8-dimethylidene-3a,4,5a,6,7,8a,9,9a-octahydro-1H-azuleno[6,5-b]furan-2-one (PubChem CID 15857816) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3aR,5aR,8aR,9R,9aS)-9-hydroxy-1-(methoxymethyl)-5,8-dimethylidene-3a,4,5a,6,7,8a,9,9a-octahydro-1H-azuleno[6,5-b]furan-2-one.
| Compound Name | (3aR,5aR,8aR,9R,9aS)-9-hydroxy-1-(methoxymethyl)-5,8-dimethylidene-3a,4,5a,6,7,8a,9,9a-octahydro-1H-azuleno[6,5-b]furan-2-one |
|---|---|
| PubChem CID | 15857816 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3aR,5aR,8aR,9R,9aS)-9-hydroxy-1-(methoxymethyl)-5,8-dimethylidene-3a,4,5a,6,7,8a,9,9a-octahydro-1H-azuleno[6,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(=C)C[C@H]3OC(=O)C(COC)[C@H]3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C16H22O4/c1-8-4-5-10-9(2)6-12-14(15(17)13(8)10)11(7-19-3)16(18)20-12/h10-15,17H,1-2,4-7H2,3H3/t10-,11?,12+,13-,14+,15+/m0/s1 |
| InChIKey | ZVFKPLSEFMPUGG-RODDURHISA-N |
| XLogP | 1.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|