C13H18O3 — CID 15857892
(7'S,7'aS)-7',7'a-dimethylspiro[1,3-dioxolane-2,6'-1,4,5,7-tetrahydroindene]-2'-one (PubChem CID 15857892) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (7'S,7'aS)-7',7'a-dimethylspiro[1,3-dioxolane-2,6'-1,4,5,7-tetrahydroindene]-2'-one.
| Compound Name | (7'S,7'aS)-7',7'a-dimethylspiro[1,3-dioxolane-2,6'-1,4,5,7-tetrahydroindene]-2'-one |
|---|---|
| PubChem CID | 15857892 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (7'S,7'aS)-7',7'a-dimethylspiro[1,3-dioxolane-2,6'-1,4,5,7-tetrahydroindene]-2'-one |
| SMILES | C[C@@H]1C2(CCC3=CC(=O)C[C@]31C)OCCO2 |
| InChI | InChI=1S/C13H18O3/c1-9-12(2)8-11(14)7-10(12)3-4-13(9)15-5-6-16-13/h7,9H,3-6,8H2,1-2H3/t9-,12-/m0/s1 |
| InChIKey | KCUYTVFUNYAQKD-CABZTGNLSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |