C32H42BrFN2O5 — CID 158582333
tert-butyl (2S)-4-benzyl-2-[(1S,2S)-3-[3-(6-bromohex-2-enoxy)-5-fluorophenyl]-1-hydroxy-2-methylpropyl]-3-oxopiperazine-1-carboxylate (PubChem CID 158582333) has the molecular formula C32H42BrFN2O5 and a molecular weight of 633.60 g/mol. Its IUPAC name is tert-butyl (2S)-4-benzyl-2-[(1S,2S)-3-[3-(6-bromohex-2-enoxy)-5-fluorophenyl]-1-hydroxy-2-methylpropyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-benzyl-2-[(1S,2S)-3-[3-(6-bromohex-2-enoxy)-5-fluorophenyl]-1-hydroxy-2-methylpropyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 158582333 |
| Molecular Formula | C32H42BrFN2O5 |
| Molecular Weight | 633.60 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | tert-butyl (2S)-4-benzyl-2-[(1S,2S)-3-[3-(6-bromohex-2-enoxy)-5-fluorophenyl]-1-hydroxy-2-methylpropyl]-3-oxopiperazine-1-carboxylate |
| SMILES | C[C@@H](Cc1cc(F)cc(OCC=CCCCBr)c1)[C@H](O)[C@H]1C(=O)N(Cc2ccccc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H42BrFN2O5/c1-23(18-25-19-26(34)21-27(20-25)40-17-11-6-5-10-14-33)29(37)28-30(38)35(22-24-12-8-7-9-13-24)15-16-36(28)31(39)41-32(2,3)4/h6-9,11-13,19-21,23,28-29,37H,5,10,14-18,22H2,1-4H3/t23-,28-,29-/m0/s1 |
| InChIKey | YGKOTJOQHDIJIL-OIFPXGRLSA-N |
| XLogP | 6.12 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|