C45H53BrFN3O4 — CID 173297024
tert-butyl (2S)-4-benzyl-2-[(2S)-3-[3-(6-bromohex-2-enoxy)-5-fluorophenyl]-2-(dibenzylamino)propyl]-3-oxopiperazine-1-carboxylate (PubChem CID 173297024) has the molecular formula C45H53BrFN3O4 and a molecular weight of 798.84 g/mol. Its IUPAC name is tert-butyl (2S)-4-benzyl-2-[(2S)-3-[3-(6-bromohex-2-enoxy)-5-fluorophenyl]-2-(dibenzylamino)propyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-benzyl-2-[(2S)-3-[3-(6-bromohex-2-enoxy)-5-fluorophenyl]-2-(dibenzylamino)propyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 173297024 |
| Molecular Formula | C45H53BrFN3O4 |
| Molecular Weight | 798.84 g/mol |
| Exact Mass | 797.32 |
| IUPAC Name | tert-butyl (2S)-4-benzyl-2-[(2S)-3-[3-(6-bromohex-2-enoxy)-5-fluorophenyl]-2-(dibenzylamino)propyl]-3-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)C(=O)[C@@H]1C[C@H](Cc1cc(F)cc(OCC=CCCCBr)c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C45H53BrFN3O4/c1-45(2,3)54-44(52)50-25-24-48(32-35-17-9-6-10-18-35)43(51)42(50)31-40(28-38-27-39(47)30-41(29-38)53-26-16-5-4-15-23-46)49(33-36-19-11-7-12-20-36)34-37-21-13-8-14-22-37/h5-14,16-22,27,29-30,40,42H,4,15,23-26,28,31-34H2,1-3H3/t40-,42-/m0/s1 |
| InChIKey | LQWLCJWFZCWQKE-VYQNARHWSA-N |
| XLogP | 9.59 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.84 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|