C12H16ClN4O+ — CID 158583547
(1,3-dimethyl-2H-imidazole-1,3-diium-2-yl)-(4-methoxyphenyl)diazene chloride (PubChem CID 158583547) has the molecular formula C12H16ClN4O+ and a molecular weight of 267.74 g/mol. Its IUPAC name is (1,3-dimethyl-2H-imidazole-1,3-diium-2-yl)-(4-methoxyphenyl)diazene chloride.
| Compound Name | (1,3-dimethyl-2H-imidazole-1,3-diium-2-yl)-(4-methoxyphenyl)diazene chloride |
|---|---|
| PubChem CID | 158583547 |
| Molecular Formula | C12H16ClN4O+ |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (1,3-dimethyl-2H-imidazole-1,3-diium-2-yl)-(4-methoxyphenyl)diazene chloride |
| SMILES | COc1ccc(/N=N/C2[N+](C)=CC=[N+]2C)cc1.[Cl-] |
| InChI | InChI=1S/C12H16N4O.ClH/c1-15-8-9-16(2)12(15)14-13-10-4-6-11(17-3)7-5-10;/h4-9,12H,1-3H3;1H/q+2;/p-1/b14-13+; |
| InChIKey | IHHMKIQUCQIOKV-IERUDJENSA-M |
| XLogP | -1.49 |
| TPSA | 39.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|