C23H28Cl2N6O2 — CID 158583853
2,6-dichloro-N-[5-[1-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-4-yl]amino]ethenyl]-1H-pyrazol-4-yl]benzamide (PubChem CID 158583853) has the molecular formula C23H28Cl2N6O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is 2,6-dichloro-N-[5-[1-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-4-yl]amino]ethenyl]-1H-pyrazol-4-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[5-[1-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-4-yl]amino]ethenyl]-1H-pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 158583853 |
| Molecular Formula | C23H28Cl2N6O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2,6-dichloro-N-[5-[1-[[1-[(E)-4-(dimethylamino)but-2-enoyl]piperidin-4-yl]amino]ethenyl]-1H-pyrazol-4-yl]benzamide |
| SMILES | C=C(NC1CCN(C(=O)/C=C/CN(C)C)CC1)c1[nH]ncc1NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H28Cl2N6O2/c1-15(27-16-9-12-31(13-10-16)20(32)8-5-11-30(2)3)22-19(14-26-29-22)28-23(33)21-17(24)6-4-7-18(21)25/h4-8,14,16,27H,1,9-13H2,2-3H3,(H,26,29)(H,28,33)/b8-5+ |
| InChIKey | RHWHDXWUJCJXPQ-VMPITWQZSA-N |
| XLogP | 3.64 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|