C24H24Cl2N6O3 — CID 151732622
4-[(2,6-dichlorobenzoyl)amino]-N-[[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]methyl]-1H-pyrazole-5-carboxamide (PubChem CID 151732622) has the molecular formula C24H24Cl2N6O3 and a molecular weight of 515.40 g/mol. Its IUPAC name is 4-[(2,6-dichlorobenzoyl)amino]-N-[[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[(2,6-dichlorobenzoyl)amino]-N-[[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 151732622 |
| Molecular Formula | C24H24Cl2N6O3 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 4-[(2,6-dichlorobenzoyl)amino]-N-[[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]methyl]-1H-pyrazole-5-carboxamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccc(CNC(=O)c2[nH]ncc2NC(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C24H24Cl2N6O3/c1-32(2)12-4-7-20(33)29-16-10-8-15(9-11-16)13-27-24(35)22-19(14-28-31-22)30-23(34)21-17(25)5-3-6-18(21)26/h3-11,14H,12-13H2,1-2H3,(H,27,35)(H,28,31)(H,29,33)(H,30,34)/b7-4+ |
| InChIKey | RKWGLUFSAMFDLN-QPJJXVBHSA-N |
| XLogP | 3.96 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|