C23H24Cl2N6O3 — CID 157374982
N-[3-amino-4-[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]anilino]-1-imino-4-oxobut-2-en-2-yl]-2,6-dichlorobenzamide (PubChem CID 157374982) has the molecular formula C23H24Cl2N6O3 and a molecular weight of 503.39 g/mol. Its IUPAC name is N-[3-amino-4-[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]anilino]-1-imino-4-oxobut-2-en-2-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[3-amino-4-[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]anilino]-1-imino-4-oxobut-2-en-2-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 157374982 |
| Molecular Formula | C23H24Cl2N6O3 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | N-[3-amino-4-[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]anilino]-1-imino-4-oxobut-2-en-2-yl]-2,6-dichlorobenzamide |
| SMILES | [H]/N=C/C(NC(=O)c1c(Cl)cccc1Cl)=C(N)C(=O)Nc1ccc(NC(=O)/C=C/CN(C)C)cc1 |
| InChI | InChI=1S/C23H24Cl2N6O3/c1-31(2)12-4-7-19(32)28-14-8-10-15(11-9-14)29-23(34)21(27)18(13-26)30-22(33)20-16(24)5-3-6-17(20)25/h3-11,13,26H,12,27H2,1-2H3,(H,28,32)(H,29,34)(H,30,33)/b7-4+,21-18?,26-13+ |
| InChIKey | SVIMPMKZHSJQAQ-ZVSHYENASA-N |
| XLogP | 3.24 |
| TPSA | 140.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|