C23H23Cl3N6O3 — CID 171649610
N-[(E,1E)-3-amino-1-[(4-chlorophenyl)carbamoylimino]-4-oxo-4-(piperidin-4-ylamino)but-2-en-2-yl]-2,6-dichlorobenzamide (PubChem CID 171649610) has the molecular formula C23H23Cl3N6O3 and a molecular weight of 537.84 g/mol. Its IUPAC name is N-[(E,1E)-3-amino-1-[(4-chlorophenyl)carbamoylimino]-4-oxo-4-(piperidin-4-ylamino)but-2-en-2-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[(E,1E)-3-amino-1-[(4-chlorophenyl)carbamoylimino]-4-oxo-4-(piperidin-4-ylamino)but-2-en-2-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 171649610 |
| Molecular Formula | C23H23Cl3N6O3 |
| Molecular Weight | 537.84 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | N-[(E,1E)-3-amino-1-[(4-chlorophenyl)carbamoylimino]-4-oxo-4-(piperidin-4-ylamino)but-2-en-2-yl]-2,6-dichlorobenzamide |
| SMILES | N/C(C(=O)NC1CCNCC1)=C(\C=N\C(=O)Nc1ccc(Cl)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H23Cl3N6O3/c24-13-4-6-14(7-5-13)31-23(35)29-12-18(20(27)22(34)30-15-8-10-28-11-9-15)32-21(33)19-16(25)2-1-3-17(19)26/h1-7,12,15,28H,8-11,27H2,(H,30,34)(H,31,35)(H,32,33)/b20-18+,29-12+ |
| InChIKey | VDWSSKUTPNNHJV-ZNEXPUJASA-N |
| XLogP | 3.72 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|