C22H19Cl2IN6O3 — CID 153382603
4-[(2,6-dichlorobenzoyl)amino]-N-[3-[[(E)-4-[iodo(methyl)amino]but-2-enoyl]amino]phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 153382603) has the molecular formula C22H19Cl2IN6O3 and a molecular weight of 613.24 g/mol. Its IUPAC name is 4-[(2,6-dichlorobenzoyl)amino]-N-[3-[[(E)-4-[iodo(methyl)amino]but-2-enoyl]amino]phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[(2,6-dichlorobenzoyl)amino]-N-[3-[[(E)-4-[iodo(methyl)amino]but-2-enoyl]amino]phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 153382603 |
| Molecular Formula | C22H19Cl2IN6O3 |
| Molecular Weight | 613.24 g/mol |
| Exact Mass | 611.99 |
| IUPAC Name | 4-[(2,6-dichlorobenzoyl)amino]-N-[3-[[(E)-4-[iodo(methyl)amino]but-2-enoyl]amino]phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | CN(I)C/C=C/C(=O)Nc1cccc(NC(=O)c2[nH]ncc2NC(=O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C22H19Cl2IN6O3/c1-31(25)10-4-9-18(32)27-13-5-2-6-14(11-13)28-22(34)20-17(12-26-30-20)29-21(33)19-15(23)7-3-8-16(19)24/h2-9,11-12H,10H2,1H3,(H,26,30)(H,27,32)(H,28,34)(H,29,33)/b9-4+ |
| InChIKey | UWSSHYQVVRKHHQ-RUDMXATFSA-N |
| XLogP | 5.00 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.24 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|