C22H18Cl2F3IN6 — CID 158583951
2-chloro-4-iodo-5-methylpyridine;2-chloro-N-pyridin-2-yl-5-(trifluoromethyl)pyridin-4-amine;pyridin-2-amine (PubChem CID 158583951) has the molecular formula C22H18Cl2F3IN6 and a molecular weight of 621.23 g/mol. Its IUPAC name is 2-chloro-4-iodo-5-methylpyridine;2-chloro-N-pyridin-2-yl-5-(trifluoromethyl)pyridin-4-amine;pyridin-2-amine.
| Compound Name | 2-chloro-4-iodo-5-methylpyridine;2-chloro-N-pyridin-2-yl-5-(trifluoromethyl)pyridin-4-amine;pyridin-2-amine |
|---|---|
| PubChem CID | 158583951 |
| Molecular Formula | C22H18Cl2F3IN6 |
| Molecular Weight | 621.23 g/mol |
| Exact Mass | 620.00 |
| IUPAC Name | 2-chloro-4-iodo-5-methylpyridine;2-chloro-N-pyridin-2-yl-5-(trifluoromethyl)pyridin-4-amine;pyridin-2-amine |
| SMILES | Cc1cnc(Cl)cc1I.FC(F)(F)c1cnc(Cl)cc1Nc1ccccn1.Nc1ccccn1 |
| InChI | InChI=1S/C11H7ClF3N3.C6H5ClIN.C5H6N2/c12-9-5-8(7(6-17-9)11(13,14)15)18-10-3-1-2-4-16-10;1-4-3-9-6(7)2-5(4)8;6-5-3-1-2-4-7-5/h1-6H,(H,16,17,18);2-3H,1H3;1-4H,(H2,6,7) |
| InChIKey | HTPBWZFJRZAGIS-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.23 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|