C21H18BrClN2OS — CID 158585900
2-amino-3-bromo-N-[(5-chloro-2-phenylsulfanylphenyl)methyl]-5-methylbenzamide (PubChem CID 158585900) has the molecular formula C21H18BrClN2OS and a molecular weight of 461.81 g/mol. Its IUPAC name is 2-amino-3-bromo-N-[(5-chloro-2-phenylsulfanylphenyl)methyl]-5-methylbenzamide.
| Compound Name | 2-amino-3-bromo-N-[(5-chloro-2-phenylsulfanylphenyl)methyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 158585900 |
| Molecular Formula | C21H18BrClN2OS |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | 2-amino-3-bromo-N-[(5-chloro-2-phenylsulfanylphenyl)methyl]-5-methylbenzamide |
| SMILES | Cc1cc(Br)c(N)c(C(=O)NCc2cc(Cl)ccc2Sc2ccccc2)c1 |
| InChI | InChI=1S/C21H18BrClN2OS/c1-13-9-17(20(24)18(22)10-13)21(26)25-12-14-11-15(23)7-8-19(14)27-16-5-3-2-4-6-16/h2-11H,12,24H2,1H3,(H,25,26) |
| InChIKey | HTVALQLEVHTYHE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|