C17H17Br2ClN2O3S — CID 118042864
2-amino-3,5-dibromo-N-[(5-chloro-2-ethylsulfonylphenyl)methyl]-4-methylbenzamide (PubChem CID 118042864) has the molecular formula C17H17Br2ClN2O3S and a molecular weight of 524.66 g/mol. Its IUPAC name is 2-amino-3,5-dibromo-N-[(5-chloro-2-ethylsulfonylphenyl)methyl]-4-methylbenzamide.
| Compound Name | 2-amino-3,5-dibromo-N-[(5-chloro-2-ethylsulfonylphenyl)methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 118042864 |
| Molecular Formula | C17H17Br2ClN2O3S |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 521.90 |
| IUPAC Name | 2-amino-3,5-dibromo-N-[(5-chloro-2-ethylsulfonylphenyl)methyl]-4-methylbenzamide |
| SMILES | CCS(=O)(=O)c1ccc(Cl)cc1CNC(=O)c1cc(Br)c(C)c(Br)c1N |
| InChI | InChI=1S/C17H17Br2ClN2O3S/c1-3-26(24,25)14-5-4-11(20)6-10(14)8-22-17(23)12-7-13(18)9(2)15(19)16(12)21/h4-7H,3,8,21H2,1-2H3,(H,22,23) |
| InChIKey | ARUQAVSYBJBGCQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|