C60H94O5P2 — CID 158586699
[4-(2-phenylpropan-2-yl)phenoxy]-(2-propylheptoxy)phosphane;[4-(2-phenylpropan-2-yl)phenyl] bis(2-propylheptyl) phosphite (PubChem CID 158586699) has the molecular formula C60H94O5P2 and a molecular weight of 957.36 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenoxy]-(2-propylheptoxy)phosphane;[4-(2-phenylpropan-2-yl)phenyl] bis(2-propylheptyl) phosphite.
| Compound Name | [4-(2-phenylpropan-2-yl)phenoxy]-(2-propylheptoxy)phosphane;[4-(2-phenylpropan-2-yl)phenyl] bis(2-propylheptyl) phosphite |
|---|---|
| PubChem CID | 158586699 |
| Molecular Formula | C60H94O5P2 |
| Molecular Weight | 957.36 g/mol |
| Exact Mass | 956.66 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenoxy]-(2-propylheptoxy)phosphane;[4-(2-phenylpropan-2-yl)phenyl] bis(2-propylheptyl) phosphite |
| SMILES | CCCCCC(CCC)COP(OCC(CCC)CCCCC)Oc1ccc(C(C)(C)c2ccccc2)cc1.CCCCCC(CCC)COPOc1ccc(C(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H57O3P.C25H37O2P/c1-7-11-14-20-30(18-9-3)28-36-39(37-29-31(19-10-4)21-15-12-8-2)38-34-26-24-33(25-27-34)35(5,6)32-22-16-13-17-23-32;1-5-7-9-13-21(12-6-2)20-26-28-27-24-18-16-23(17-19-24)25(3,4)22-14-10-8-11-15-22/h13,16-17,22-27,30-31H,7-12,14-15,18-21,28-29H2,1-6H3;8,10-11,14-19,21,28H,5-7,9,12-13,20H2,1-4H3 |
| InChIKey | HTXMBTBNRGMZIC-UHFFFAOYSA-N |
| XLogP | 19.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.36 |
| LogP ≤ 5 | 19.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|