C24H30N4O5S — CID 15858674
(2S)-1-[1-(4-aminophenyl)sulfonylpiperidine-4-carbonyl]-N-(2-methoxyethyl)-2,3-dihydroindole-2-carboxamide (PubChem CID 15858674) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is (2S)-1-[1-(4-aminophenyl)sulfonylpiperidine-4-carbonyl]-N-(2-methoxyethyl)-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-[1-(4-aminophenyl)sulfonylpiperidine-4-carbonyl]-N-(2-methoxyethyl)-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 15858674 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (2S)-1-[1-(4-aminophenyl)sulfonylpiperidine-4-carbonyl]-N-(2-methoxyethyl)-2,3-dihydroindole-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1Cc2ccccc2N1C(=O)C1CCN(S(=O)(=O)c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O5S/c1-33-15-12-26-23(29)22-16-18-4-2-3-5-21(18)28(22)24(30)17-10-13-27(14-11-17)34(31,32)20-8-6-19(25)7-9-20/h2-9,17,22H,10-16,25H2,1H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | BLWKSJSJTRSTGD-QFIPXVFZSA-N |
| XLogP | 1.39 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|