About 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium
1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium (PubChem CID 158593106) has the molecular formula C10H20F2NO+
and a molecular weight of 208.27 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium.
Molecular Properties
| Compound Name | 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium |
| PubChem CID | 158593106 |
| Molecular Formula | C10H20F2NO+ |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium |
| SMILES | C[N+]1(CCOCC(F)F)CCCCC1 |
| InChI | InChI=1S/C10H20F2NO/c1-13(5-3-2-4-6-13)7-8-14-9-10(11)12/h10H,2-9H2,1H3/q+1 |
| InChIKey | PBUHBEHIXRXLKM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium?
The IUPAC name of 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium (CID 158593106) is 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium.
What is the SMILES notation for 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium?
The canonical SMILES for 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium is C[N+]1(CCOCC(F)F)CCCCC1.
What is the InChIKey of 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium?
The InChIKey is PBUHBEHIXRXLKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F2NO/c1-13(5-3-2-4-6-13)7-8-14-9-10(11)12/h10H,2-9H2,1H3/q+1.
What are the key properties of 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium?
1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium has a molecular weight of 208.27 g/mol, XLogP of 1.90, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,2-difluoroethoxy)ethyl]-1-methylpiperidin-1-ium is sourced from PubChem (CID 158593106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).