C11H16F4O2 — CID 158595662
2-methylprop-1-ene;2,2,3,3-tetrafluoro-4-[2-(oxiran-2-yl)ethyl]oxetane (PubChem CID 158595662) has the molecular formula C11H16F4O2 and a molecular weight of 256.24 g/mol. Its IUPAC name is 2-methylprop-1-ene;2,2,3,3-tetrafluoro-4-[2-(oxiran-2-yl)ethyl]oxetane.
| Compound Name | 2-methylprop-1-ene;2,2,3,3-tetrafluoro-4-[2-(oxiran-2-yl)ethyl]oxetane |
|---|---|
| PubChem CID | 158595662 |
| Molecular Formula | C11H16F4O2 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-methylprop-1-ene;2,2,3,3-tetrafluoro-4-[2-(oxiran-2-yl)ethyl]oxetane |
| SMILES | C=C(C)C.FC1(F)OC(CCC2CO2)C1(F)F |
| InChI | InChI=1S/C7H8F4O2.C4H8/c8-6(9)5(13-7(6,10)11)2-1-4-3-12-4;1-4(2)3/h4-5H,1-3H2;1H2,2-3H3 |
| InChIKey | HUZPKPQWRCWXBX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|