C13H21F5O2 — CID 159980517
2-(2-ethoxyethyl)-3-(2,2,3,3,3-pentafluoropropyl)oxirane;2-methylprop-1-ene (PubChem CID 159980517) has the molecular formula C13H21F5O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-3-(2,2,3,3,3-pentafluoropropyl)oxirane;2-methylprop-1-ene.
| Compound Name | 2-(2-ethoxyethyl)-3-(2,2,3,3,3-pentafluoropropyl)oxirane;2-methylprop-1-ene |
|---|---|
| PubChem CID | 159980517 |
| Molecular Formula | C13H21F5O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-(2-ethoxyethyl)-3-(2,2,3,3,3-pentafluoropropyl)oxirane;2-methylprop-1-ene |
| SMILES | C=C(C)C.CCOCCC1OC1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5O2.C4H8/c1-2-15-4-3-6-7(16-6)5-8(10,11)9(12,13)14;1-4(2)3/h6-7H,2-5H2,1H3;1H2,2-3H3 |
| InChIKey | OFRZIYLZDBFWFE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|