C16H31N3 — CID 158595715
3-(tert-butylamino)-1-cyclohexylpyrrolidine-3-carbonitrile;methane (PubChem CID 158595715) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is 3-(tert-butylamino)-1-cyclohexylpyrrolidine-3-carbonitrile;methane.
| Compound Name | 3-(tert-butylamino)-1-cyclohexylpyrrolidine-3-carbonitrile;methane |
|---|---|
| PubChem CID | 158595715 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 3-(tert-butylamino)-1-cyclohexylpyrrolidine-3-carbonitrile;methane |
| SMILES | C.CC(C)(C)NC1(C#N)CCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C15H27N3.CH4/c1-14(2,3)17-15(11-16)9-10-18(12-15)13-7-5-4-6-8-13;/h13,17H,4-10,12H2,1-3H3;1H4 |
| InChIKey | HUZSZVGPOXKETF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |