C35H39F5O6S2 — CID 158596134
2-[2-(4-butan-2-ylphenoxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;methane;triphenylsulfanium (PubChem CID 158596134) has the molecular formula C35H39F5O6S2 and a molecular weight of 714.82 g/mol. Its IUPAC name is 2-[2-(4-butan-2-ylphenoxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;methane;triphenylsulfanium.
| Compound Name | 2-[2-(4-butan-2-ylphenoxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;methane;triphenylsulfanium |
|---|---|
| PubChem CID | 158596134 |
| Molecular Formula | C35H39F5O6S2 |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.21 |
| IUPAC Name | 2-[2-(4-butan-2-ylphenoxy)acetyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate;methane;triphenylsulfanium |
| SMILES | C.C.CCC(C)c1ccc(OCC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C15H17F5O6S.2CH4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-9(2)10-4-6-11(7-5-10)25-8-12(21)26-13(14(16,17)18)15(19,20)27(22,23)24;;/h1-15H;4-7,9,13H,3,8H2,1-2H3,(H,22,23,24);2*1H4/q+1;;;/p-1 |
| InChIKey | HVAWZDUTNVVOMI-UHFFFAOYSA-M |
| XLogP | 9.25 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|