C24H42O7 — CID 158602354
(1S,4R)-4-[(2S,4R,6R)-6-[(2S)-2,3-dihydroxypropyl]-4-hydroxy-5,5-dimethyloxan-2-yl]-1-hydroxy-1-[(2R,5R,6R)-2,5,6-trimethyl-4-methylideneoxan-2-yl]pentan-2-one (PubChem CID 158602354) has the molecular formula C24H42O7 and a molecular weight of 442.59 g/mol. Its IUPAC name is (1S,4R)-4-[(2S,4R,6R)-6-[(2S)-2,3-dihydroxypropyl]-4-hydroxy-5,5-dimethyloxan-2-yl]-1-hydroxy-1-[(2R,5R,6R)-2,5,6-trimethyl-4-methylideneoxan-2-yl]pentan-2-one.
| Compound Name | (1S,4R)-4-[(2S,4R,6R)-6-[(2S)-2,3-dihydroxypropyl]-4-hydroxy-5,5-dimethyloxan-2-yl]-1-hydroxy-1-[(2R,5R,6R)-2,5,6-trimethyl-4-methylideneoxan-2-yl]pentan-2-one |
|---|---|
| PubChem CID | 158602354 |
| Molecular Formula | C24H42O7 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (1S,4R)-4-[(2S,4R,6R)-6-[(2S)-2,3-dihydroxypropyl]-4-hydroxy-5,5-dimethyloxan-2-yl]-1-hydroxy-1-[(2R,5R,6R)-2,5,6-trimethyl-4-methylideneoxan-2-yl]pentan-2-one |
| SMILES | C=C1C[C@](C)([C@H](O)C(=O)C[C@@H](C)[C@@H]2C[C@@H](O)C(C)(C)[C@@H](C[C@H](O)CO)O2)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C24H42O7/c1-13(19-10-20(28)23(5,6)21(30-19)9-17(26)12-25)8-18(27)22(29)24(7)11-14(2)15(3)16(4)31-24/h13,15-17,19-22,25-26,28-29H,2,8-12H2,1,3-7H3/t13-,15-,16-,17+,19+,20-,21-,22-,24-/m1/s1 |
| InChIKey | ULJRCCZVNJHMJO-NIZBGJNOSA-N |
| XLogP | 1.99 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|