C16H30O4 — CID 102202843
(2S,4S,6R)-6-(2-hydroxybutyl)-2-[(2S)-2-hydroxypent-4-enyl]-3,3-dimethyloxan-4-ol (PubChem CID 102202843) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is (2S,4S,6R)-6-(2-hydroxybutyl)-2-[(2S)-2-hydroxypent-4-enyl]-3,3-dimethyloxan-4-ol.
| Compound Name | (2S,4S,6R)-6-(2-hydroxybutyl)-2-[(2S)-2-hydroxypent-4-enyl]-3,3-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 102202843 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (2S,4S,6R)-6-(2-hydroxybutyl)-2-[(2S)-2-hydroxypent-4-enyl]-3,3-dimethyloxan-4-ol |
| SMILES | C=CC[C@H](O)C[C@@H]1O[C@H](CC(O)CC)C[C@H](O)C1(C)C |
| InChI | InChI=1S/C16H30O4/c1-5-7-12(18)9-15-16(3,4)14(19)10-13(20-15)8-11(17)6-2/h5,11-15,17-19H,1,6-10H2,2-4H3/t11?,12-,13+,14-,15-/m0/s1 |
| InChIKey | MDTNRFQZODVEHJ-CHZLEKFTSA-N |
| XLogP | 2.02 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|