C13H23NO2 — CID 58797942
1-[(2R,4R,6S)-6-isocyano-3,3,4-trimethyloxan-2-yl]butan-2-ol (PubChem CID 58797942) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-[(2R,4R,6S)-6-isocyano-3,3,4-trimethyloxan-2-yl]butan-2-ol.
| Compound Name | 1-[(2R,4R,6S)-6-isocyano-3,3,4-trimethyloxan-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 58797942 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-[(2R,4R,6S)-6-isocyano-3,3,4-trimethyloxan-2-yl]butan-2-ol |
| SMILES | [C-]#[N+][C@@H]1C[C@@H](C)C(C)(C)[C@@H](CC(O)CC)O1 |
| InChI | InChI=1S/C13H23NO2/c1-6-10(15)8-11-13(3,4)9(2)7-12(14-5)16-11/h9-12,15H,6-8H2,1-4H3/t9-,10?,11-,12+/m1/s1 |
| InChIKey | CVFVITLXBOTZLM-WAAKLRNESA-N |
| XLogP | 2.84 |
| TPSA | 33.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|