C53H47BN2O2Si — CID 158602869
8,14-bis(6-tert-butyldibenzofuran-4-yl)-11,22,22-trimethyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 158602869) has the molecular formula C53H47BN2O2Si and a molecular weight of 782.87 g/mol. Its IUPAC name is 8,14-bis(6-tert-butyldibenzofuran-4-yl)-11,22,22-trimethyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8,14-bis(6-tert-butyldibenzofuran-4-yl)-11,22,22-trimethyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 158602869 |
| Molecular Formula | C53H47BN2O2Si |
| Molecular Weight | 782.87 g/mol |
| Exact Mass | 782.35 |
| IUPAC Name | 8,14-bis(6-tert-butyldibenzofuran-4-yl)-11,22,22-trimethyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1cc2c3c(c1)N(c1cccc4c1oc1c(C(C)(C)C)cccc14)c1cccc4c1B3c1c(cccc1[Si]4(C)C)N2c1cccc2c1oc1c(C(C)(C)C)cccc12 |
| InChI | InChI=1S/C53H47BN2O2Si/c1-30-28-41-45-42(29-30)56(40-25-13-19-34-32-17-11-21-36(53(5,6)7)49(32)58-51(34)40)38-23-15-27-44-47(38)54(45)46-37(22-14-26-43(46)59(44,8)9)55(41)39-24-12-18-33-31-16-10-20-35(52(2,3)4)48(31)57-50(33)39/h10-29H,1-9H3 |
| InChIKey | QMCYHNKETHMBKA-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.87 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|