C42H45BN2Si — CID 159207527
8,14-bis(4-tert-butylphenyl)-5,11,22,22-tetramethyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 159207527) has the molecular formula C42H45BN2Si and a molecular weight of 616.73 g/mol. Its IUPAC name is 8,14-bis(4-tert-butylphenyl)-5,11,22,22-tetramethyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8,14-bis(4-tert-butylphenyl)-5,11,22,22-tetramethyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 159207527 |
| Molecular Formula | C42H45BN2Si |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | 8,14-bis(4-tert-butylphenyl)-5,11,22,22-tetramethyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1cc2c3c(c1)N(c1ccc(C(C)(C)C)cc1)c1cc(C)cc4c1B3c1c(cccc1[Si]4(C)C)N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C42H45BN2Si/c1-26-22-33-38-34(23-26)45(31-20-16-29(17-21-31)42(6,7)8)35-24-27(2)25-37-40(35)43(38)39-32(12-11-13-36(39)46(37,9)10)44(33)30-18-14-28(15-19-30)41(3,4)5/h11-25H,1-10H3 |
| InChIKey | YIXZMEFBVGZNDO-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|