C39H43BN2S2 — CID 169041447
7,13-bis(4-tert-butylphenyl)-3,4,10,16,17-pentamethyl-5,15-dithia-7,13-diaza-1-borapentacyclo[10.6.1.02,6.08,19.014,18]nonadeca-2(6),3,8,10,12(19),14(18),16-heptaene (PubChem CID 169041447) has the molecular formula C39H43BN2S2 and a molecular weight of 614.73 g/mol. Its IUPAC name is 7,13-bis(4-tert-butylphenyl)-3,4,10,16,17-pentamethyl-5,15-dithia-7,13-diaza-1-borapentacyclo[10.6.1.02,6.08,19.014,18]nonadeca-2(6),3,8,10,12(19),14(18),16-heptaene.
| Compound Name | 7,13-bis(4-tert-butylphenyl)-3,4,10,16,17-pentamethyl-5,15-dithia-7,13-diaza-1-borapentacyclo[10.6.1.02,6.08,19.014,18]nonadeca-2(6),3,8,10,12(19),14(18),16-heptaene |
|---|---|
| PubChem CID | 169041447 |
| Molecular Formula | C39H43BN2S2 |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | 7,13-bis(4-tert-butylphenyl)-3,4,10,16,17-pentamethyl-5,15-dithia-7,13-diaza-1-borapentacyclo[10.6.1.02,6.08,19.014,18]nonadeca-2(6),3,8,10,12(19),14(18),16-heptaene |
| SMILES | Cc1cc2c3c(c1)N(c1ccc(C(C)(C)C)cc1)c1sc(C)c(C)c1B3c1c(sc(C)c1C)N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C39H43BN2S2/c1-22-20-31-35-32(21-22)42(30-18-14-28(15-19-30)39(9,10)11)37-34(24(3)26(5)44-37)40(35)33-23(2)25(4)43-36(33)41(31)29-16-12-27(13-17-29)38(6,7)8/h12-21H,1-11H3 |
| InChIKey | XFYFEIYTOBNGKR-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|