C48H60BN3S — CID 163424508
4,17-ditert-butyl-13-(4-tert-butylphenyl)-7-(3,5-ditert-butylphenyl)-10-methyl-5-thia-3,7,13-triaza-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,8,10,12(20),14(19),15,17-octaene (PubChem CID 163424508) has the molecular formula C48H60BN3S and a molecular weight of 721.91 g/mol. Its IUPAC name is 4,17-ditert-butyl-13-(4-tert-butylphenyl)-7-(3,5-ditert-butylphenyl)-10-methyl-5-thia-3,7,13-triaza-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,8,10,12(20),14(19),15,17-octaene.
| Compound Name | 4,17-ditert-butyl-13-(4-tert-butylphenyl)-7-(3,5-ditert-butylphenyl)-10-methyl-5-thia-3,7,13-triaza-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,8,10,12(20),14(19),15,17-octaene |
|---|---|
| PubChem CID | 163424508 |
| Molecular Formula | C48H60BN3S |
| Molecular Weight | 721.91 g/mol |
| Exact Mass | 721.46 |
| IUPAC Name | 4,17-ditert-butyl-13-(4-tert-butylphenyl)-7-(3,5-ditert-butylphenyl)-10-methyl-5-thia-3,7,13-triaza-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,8,10,12(20),14(19),15,17-octaene |
| SMILES | Cc1cc2c3c(c1)N(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1sc(C(C)(C)C)nc1B3c1cc(C(C)(C)C)ccc1N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C48H60BN3S/c1-29-23-38-40-39(24-29)52(35-26-32(46(8,9)10)25-33(27-35)47(11,12)13)42-41(50-43(53-42)48(14,15)16)49(40)36-28-31(45(5,6)7)19-22-37(36)51(38)34-20-17-30(18-21-34)44(2,3)4/h17-28H,1-16H3 |
| InChIKey | FVDFSPAFSSCGSB-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.91 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|