C46H55BN2S — CID 169041462
10,17-ditert-butyl-7,13-bis(4-tert-butylphenyl)-4,5-dimethyl-3-thia-7,13-diaza-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaene (PubChem CID 169041462) has the molecular formula C46H55BN2S and a molecular weight of 678.84 g/mol. Its IUPAC name is 10,17-ditert-butyl-7,13-bis(4-tert-butylphenyl)-4,5-dimethyl-3-thia-7,13-diaza-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaene.
| Compound Name | 10,17-ditert-butyl-7,13-bis(4-tert-butylphenyl)-4,5-dimethyl-3-thia-7,13-diaza-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaene |
|---|---|
| PubChem CID | 169041462 |
| Molecular Formula | C46H55BN2S |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.42 |
| IUPAC Name | 10,17-ditert-butyl-7,13-bis(4-tert-butylphenyl)-4,5-dimethyl-3-thia-7,13-diaza-1-borapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaene |
| SMILES | Cc1sc2c(c1C)N(c1ccc(C(C)(C)C)cc1)c1cc(C(C)(C)C)cc3c1B2c1cc(C(C)(C)C)ccc1N3c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C46H55BN2S/c1-28-29(2)50-42-41(28)49(35-22-17-31(18-23-35)44(6,7)8)39-27-33(46(12,13)14)26-38-40(39)47(42)36-25-32(45(9,10)11)19-24-37(36)48(38)34-20-15-30(16-21-34)43(3,4)5/h15-27H,1-14H3 |
| InChIKey | PMSDVZJQQQTEAV-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|