C38H35BBr2N2 — CID 169018508
5,17-dibromo-8,14-bis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene (PubChem CID 169018508) has the molecular formula C38H35BBr2N2 and a molecular weight of 690.33 g/mol. Its IUPAC name is 5,17-dibromo-8,14-bis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene.
| Compound Name | 5,17-dibromo-8,14-bis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 169018508 |
| Molecular Formula | C38H35BBr2N2 |
| Molecular Weight | 690.33 g/mol |
| Exact Mass | 688.13 |
| IUPAC Name | 5,17-dibromo-8,14-bis(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3cc(Br)ccc3B3c4ccc(Br)cc4N(c4ccc(C(C)(C)C)cc4)c4cccc2c43)cc1 |
| InChI | InChI=1S/C38H35BBr2N2/c1-37(2,3)24-10-16-28(17-11-24)42-32-8-7-9-33-36(32)39(30-20-14-26(40)22-34(30)42)31-21-15-27(41)23-35(31)43(33)29-18-12-25(13-19-29)38(4,5)6/h7-23H,1-6H3 |
| InChIKey | BVCWPKZVXVFNOD-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.33 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|