C24H48O9 — CID 158605958
1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-(oxiran-2-ylmethoxy)propan-2-ol;1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-prop-2-enoxypropan-2-ol (PubChem CID 158605958) has the molecular formula C24H48O9 and a molecular weight of 480.64 g/mol. Its IUPAC name is 1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-(oxiran-2-ylmethoxy)propan-2-ol;1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-(oxiran-2-ylmethoxy)propan-2-ol;1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 158605958 |
| Molecular Formula | C24H48O9 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | 1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-(oxiran-2-ylmethoxy)propan-2-ol;1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)COCCOC(C)(C)C.CC(C)(C)OCCOCC(O)COCC1CO1 |
| InChI | InChI=1S/C12H24O5.C12H24O4/c1-12(2,3)17-5-4-14-6-10(13)7-15-8-11-9-16-11;1-5-6-14-9-11(13)10-15-7-8-16-12(2,3)4/h10-11,13H,4-9H2,1-3H3;5,11,13H,1,6-10H2,2-4H3 |
| InChIKey | HWFNMLZQOACMMJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|