C22H40O9 — CID 10003795
1,12-dimethyl-6-(prop-2-enoxymethyl)-2,5,8,11,14,17,20,23-octaoxabicyclo[10.6.6]tetracosane (PubChem CID 10003795) has the molecular formula C22H40O9 and a molecular weight of 448.55 g/mol. Its IUPAC name is 1,12-dimethyl-6-(prop-2-enoxymethyl)-2,5,8,11,14,17,20,23-octaoxabicyclo[10.6.6]tetracosane.
| Compound Name | 1,12-dimethyl-6-(prop-2-enoxymethyl)-2,5,8,11,14,17,20,23-octaoxabicyclo[10.6.6]tetracosane |
|---|---|
| PubChem CID | 10003795 |
| Molecular Formula | C22H40O9 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 1,12-dimethyl-6-(prop-2-enoxymethyl)-2,5,8,11,14,17,20,23-octaoxabicyclo[10.6.6]tetracosane |
| SMILES | C=CCOCC1COCCOC2(C)COCCOCC(C)(COCCOC2)OCCO1 |
| InChI | InChI=1S/C22H40O9/c1-4-5-23-14-20-15-24-10-12-30-21(2)16-25-6-8-27-18-22(3,31-13-11-29-20)19-28-9-7-26-17-21/h4,20H,1,5-19H2,2-3H3 |
| InChIKey | CVIYQPIQMZWWGP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'crown_ether', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|