C18H36O8 — CID 18327886
3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]but-1-ene (PubChem CID 18327886) has the molecular formula C18H36O8 and a molecular weight of 380.48 g/mol. Its IUPAC name is 3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]but-1-ene.
| Compound Name | 3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]but-1-ene |
|---|---|
| PubChem CID | 18327886 |
| Molecular Formula | C18H36O8 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 3,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]but-1-ene |
| SMILES | C=CC(COCCOCCOCCOC)OCCOCCOCCOC |
| InChI | InChI=1S/C18H36O8/c1-4-18(26-16-15-24-12-10-22-8-6-20-3)17-25-14-13-23-11-9-21-7-5-19-2/h4,18H,1,5-17H2,2-3H3 |
| InChIKey | SAJNEUMVWZAHFH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|