C8H16O2 — CID 19376958
3,4-diethoxybut-1-ene (PubChem CID 19376958) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 3,4-diethoxybut-1-ene.
| Compound Name | 3,4-diethoxybut-1-ene |
|---|---|
| PubChem CID | 19376958 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 3,4-diethoxybut-1-ene |
| SMILES | C=CC(COCC)OCC |
| InChI | InChI=1S/C8H16O2/c1-4-8(10-6-3)7-9-5-2/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | XPADONXQHQVBBZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|