C12H24O2 — CID 13442992
3,4-dibutoxybut-1-ene (PubChem CID 13442992) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3,4-dibutoxybut-1-ene.
| Compound Name | 3,4-dibutoxybut-1-ene |
|---|---|
| PubChem CID | 13442992 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 3,4-dibutoxybut-1-ene |
| SMILES | C=CC(COCCCC)OCCCC |
| InChI | InChI=1S/C12H24O2/c1-4-7-9-13-11-12(6-3)14-10-8-5-2/h6,12H,3-5,7-11H2,1-2H3 |
| InChIKey | ALBXYVHAQLWEMM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|