C18H34O7 — CID 10067212
12-methyl-12-[2-(2-prop-2-enoxyethoxy)ethoxymethyl]-1,4,7,10-tetraoxacyclotridecane (PubChem CID 10067212) has the molecular formula C18H34O7 and a molecular weight of 362.46 g/mol. Its IUPAC name is 12-methyl-12-[2-(2-prop-2-enoxyethoxy)ethoxymethyl]-1,4,7,10-tetraoxacyclotridecane.
| Compound Name | 12-methyl-12-[2-(2-prop-2-enoxyethoxy)ethoxymethyl]-1,4,7,10-tetraoxacyclotridecane |
|---|---|
| PubChem CID | 10067212 |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 12-methyl-12-[2-(2-prop-2-enoxyethoxy)ethoxymethyl]-1,4,7,10-tetraoxacyclotridecane |
| SMILES | C=CCOCCOCCOCC1(C)COCCOCCOCCOC1 |
| InChI | InChI=1S/C18H34O7/c1-3-4-19-5-6-20-9-12-23-15-18(2)16-24-13-10-21-7-8-22-11-14-25-17-18/h3H,1,4-17H2,2H3 |
| InChIKey | SEOQPGVVHYVZKB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|