C16H30O4 — CID 158607220
propan-2-yl 5,5-dimethyl-2-(oxan-4-yloxy)hexanoate (PubChem CID 158607220) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is propan-2-yl 5,5-dimethyl-2-(oxan-4-yloxy)hexanoate.
| Compound Name | propan-2-yl 5,5-dimethyl-2-(oxan-4-yloxy)hexanoate |
|---|---|
| PubChem CID | 158607220 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | propan-2-yl 5,5-dimethyl-2-(oxan-4-yloxy)hexanoate |
| SMILES | CC(C)OC(=O)C(CCC(C)(C)C)OC1CCOCC1 |
| InChI | InChI=1S/C16H30O4/c1-12(2)19-15(17)14(6-9-16(3,4)5)20-13-7-10-18-11-8-13/h12-14H,6-11H2,1-5H3 |
| InChIKey | QNESKYCBUCMBCZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |